Cobalt sulfate heptahydrate CAS#10026-24-1
Stable and Non-Flammable: Cobalt sulphate is chemically stable and non-flammable, making it safe for handling and storage.
Hygroscopic Nature: It readily absorbs moisture, which can be advantageous in certain industrial and chemical processes.
Distinct Physical Appearance: It forms pink to red monoclinic prismatic crystals or red granular solids, allowing easy identification and quality assessment.
Thermal Stability: Cobalt sulphate can undergo dehydration and become anhydrous at high temperatures (up to 788°F), supporting applications that require heat treatment.
Cobalt Sulfate Heptahydrate CAS# 10026-24-1
Cobalt sulfate heptahydrate appears as pink to red crystals and may also form red granular solids. It is stable, non-flammable, and odorless, with a hygroscopic nature. The compound undergoes dehydration at 41°C and 71°C and becomes anhydrous at 788°F, making it suitable for applications requiring thermal processing.
Cobalt sulfate heptahydrate Chemical Properties
| Melting point | 98 °C |
| Boiling point | 735°C |
| bulk density | 900kg/m3 |
| density | 2.03 g/mL at 25 °C(lit.) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: soluble |
| form | Solid |
| color | Red-brown |
| Specific Gravity | 1.948 |
| PH | 4 (100g/l, H2O, 20℃) |
| Water Solubility | 362 g/L (20 ºC) |
| Merck | 142448 |
| Exposure limits | ACGIH: TWA 0.02 mg/m3 |
| Stability: | Stable. Non-flammable. Hygroscopic. Dehydrates at around 41 C and 71 C. |
| InChI | 1S/Co.H2O4S.H2O/c;1-5(2,3)4;/h;(H2,1,2,3,4);1H2/q+2;;/p-2 |
| InChIKey | MEYVLGVRTYSQHI-UHFFFAOYSA-L |
| SMILES | O.[Co++].[O-]S([O-])(=O)=O |
| LogP | -1.031 (est) |
| CAS DataBase Reference | 10026-24-1(CAS DataBase Reference) |
| IARC | 2B (Vol. 86) 2006 |
| EPA Substance Registry System | Cobalt(2+) sulfate heptahydrate (10026-24-1) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 49-42/43-51/53-50/53-22-68-60 |
| Safety Statements | 53-23-36/37-45-61-60-22 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | GG3200000 |
| TSCA | Yes |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 28332930 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 |
| toxic hazardous materials or hazardous materials causing chronic effects | |
| Hazard Classifications | Acute Tox. 4 Oral |
| Aquatic Acute 1 | |
| Aquatic Chronic 1 | |
| Carc. 1B Inhalation | |
| Eye Irrit. 2 | |
| Muta. 2 | |
| Repr. 1B | |
| Resp. Sens. 1 | |
| Skin Sens. 1 | |
| Toxicity | LD50 orally in Rabbit: 582 mg/kg |
Product Application of Cobalt Sulfate Heptahydrate CAS# 10026-24-1
Cobalt sulfate heptahydrate is a common and economical source of water-soluble cobalt, with lower tendencies to deliquesce or dehydrate compared to cobalt chloride or nitrate. It is used in storage batteries, cobalt electroplating baths, and as a drier for lithographic inks and varnishes. Additionally, it finds applications in ceramics, enamels, and glazes to prevent discoloration and is used in cobalt pigments for decorating porcelain.
